C16H25IN4 — CID 75532671
1-cyclohexyl-3-prop-2-enyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 75532671) has the molecular formula C16H25IN4 and a molecular weight of 400.31 g/mol. Its IUPAC name is 1-cyclohexyl-3-prop-2-enyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-3-prop-2-enyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 75532671 |
| Molecular Formula | C16H25IN4 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 1-cyclohexyl-3-prop-2-enyl-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccccn1)NC1CCCCC1.I |
| InChI | InChI=1S/C16H24N4.HI/c1-2-11-18-16(20-14-8-4-3-5-9-14)19-13-15-10-6-7-12-17-15;/h2,6-7,10,12,14H,1,3-5,8-9,11,13H2,(H2,18,19,20);1H |
| InChIKey | ZMDNPUCLMJYDKL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|