C22H20ClN3O3 — CID 67443630
1-(4-chlorophenyl)-2-[3-[(6-hydroxy-4-methylquinolin-2-yl)amino]pyrrolidin-1-yl]ethane-1,2-dione (PubChem CID 67443630) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[3-[(6-hydroxy-4-methylquinolin-2-yl)amino]pyrrolidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(4-chlorophenyl)-2-[3-[(6-hydroxy-4-methylquinolin-2-yl)amino]pyrrolidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 67443630 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[3-[(6-hydroxy-4-methylquinolin-2-yl)amino]pyrrolidin-1-yl]ethane-1,2-dione |
| SMILES | Cc1cc(NC2CCN(C(=O)C(=O)c3ccc(Cl)cc3)C2)nc2ccc(O)cc12 |
| InChI | InChI=1S/C22H20ClN3O3/c1-13-10-20(25-19-7-6-17(27)11-18(13)19)24-16-8-9-26(12-16)22(29)21(28)14-2-4-15(23)5-3-14/h2-7,10-11,16,27H,8-9,12H2,1H3,(H,24,25) |
| InChIKey | MELBXUOWSHSJFM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|