C13H23F2NO2 — CID 67446058
tert-butyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate (PubChem CID 67446058) has the molecular formula C13H23F2NO2 and a molecular weight of 263.33 g/mol. Its IUPAC name is tert-butyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate.
| Compound Name | tert-butyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate |
|---|---|
| PubChem CID | 67446058 |
| Molecular Formula | C13H23F2NO2 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | tert-butyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate |
| SMILES | CCC(N[C@@H]1CCC(F)(F)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23F2NO2/c1-5-10(11(17)18-12(2,3)4)16-9-6-7-13(14,15)8-9/h9-10,16H,5-8H2,1-4H3/t9-,10?/m1/s1 |
| InChIKey | HMAFVHXRESHHOA-YHMJZVADSA-N |
| XLogP | 2.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |