About methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate
methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate (PubChem CID 67444614) has the molecular formula C10H17F2NO2
and a molecular weight of 221.25 g/mol. Its IUPAC name is methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate.
Molecular Properties
| Compound Name | methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate |
| PubChem CID | 67444614 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate |
| SMILES | CCC(N[C@@H]1CCC(F)(F)C1)C(=O)OC |
| InChI | InChI=1S/C10H17F2NO2/c1-3-8(9(14)15-2)13-7-4-5-10(11,12)6-7/h7-8,13H,3-6H2,1-2H3/t7-,8?/m1/s1 |
| InChIKey | RZNMMCDSJLKNHZ-GVHYBUMESA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate?
The IUPAC name of methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate (CID 67444614) is methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate.
What is the SMILES notation for methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate?
The canonical SMILES for methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate is CCC(N[C@@H]1CCC(F)(F)C1)C(=O)OC.
What is the InChIKey of methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate?
The InChIKey is RZNMMCDSJLKNHZ-GVHYBUMESA-N. The full InChI is InChI=1S/C10H17F2NO2/c1-3-8(9(14)15-2)13-7-4-5-10(11,12)6-7/h7-8,13H,3-6H2,1-2H3/t7-,8?/m1/s1.
What are the key properties of methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate?
methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate has a molecular weight of 221.25 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate is sourced from PubChem (CID 67444614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).