C10H17F2NO2 — CID 67444615
methyl (2R)-2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate (PubChem CID 67444615) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is methyl (2R)-2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate.
| Compound Name | methyl (2R)-2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate |
|---|---|
| PubChem CID | 67444615 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | methyl (2R)-2-[[(1R)-3,3-difluorocyclopentyl]amino]butanoate |
| SMILES | CC[C@@H](N[C@@H]1CCC(F)(F)C1)C(=O)OC |
| InChI | InChI=1S/C10H17F2NO2/c1-3-8(9(14)15-2)13-7-4-5-10(11,12)6-7/h7-8,13H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | RZNMMCDSJLKNHZ-HTQZYQBOSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |