C17H22N4 — CID 67446912
1-(quinolin-8-ylmethyl)-2,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrimidine (PubChem CID 67446912) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-(quinolin-8-ylmethyl)-2,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrimidine.
| Compound Name | 1-(quinolin-8-ylmethyl)-2,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 67446912 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-(quinolin-8-ylmethyl)-2,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrimidine |
| SMILES | c1cnc2c(CN3CCCN4CCNCC43)cccc2c1 |
| InChI | InChI=1S/C17H22N4/c1-4-14-6-2-7-19-17(14)15(5-1)13-21-10-3-9-20-11-8-18-12-16(20)21/h1-2,4-7,16,18H,3,8-13H2 |
| InChIKey | QVJCUAGSOYWOGL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |