C9H17N4O7P — CID 67450147
4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine;phosphoric acid (PubChem CID 67450147) has the molecular formula C9H17N4O7P and a molecular weight of 324.23 g/mol. Its IUPAC name is 4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine;phosphoric acid.
| Compound Name | 4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine;phosphoric acid |
|---|---|
| PubChem CID | 67450147 |
| Molecular Formula | C9H17N4O7P |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine;phosphoric acid |
| SMILES | O=P(O)(O)O.O=[N+]([O-])c1cncn1CCN1CCOCC1 |
| InChI | InChI=1S/C9H14N4O3.H3O4P/c14-13(15)9-7-10-8-12(9)2-1-11-3-5-16-6-4-11;1-5(2,3)4/h7-8H,1-6H2;(H3,1,2,3,4) |
| InChIKey | BJNSJVGOFDBYBJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|