C17H26N8O8 — CID 67359791
4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine (PubChem CID 67359791) has the molecular formula C17H26N8O8 and a molecular weight of 470.44 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 67359791 |
| Molecular Formula | C17H26N8O8 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one;4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine |
| SMILES | Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1.O=[N+]([O-])c1cncn1CCN1CCOCC1 |
| InChI | InChI=1S/C9H14N4O3.C8H12N4O5/c14-13(15)9-7-10-8-12(9)2-1-11-3-5-16-6-4-11;9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h7-8H,1-6H2;2-6,13-15H,1H2,(H2,9,11,16)/t;3-,4-,5-,6-/m.1/s1 |
| InChIKey | SWHQWMPFUGQOOA-WKWWPMDXSA-N |
| XLogP | -3.04 |
| TPSA | 217.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|