C13H18N4O7 — CID 67451086
but-2-enedioic acid;4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine (PubChem CID 67451086) has the molecular formula C13H18N4O7 and a molecular weight of 342.31 g/mol. Its IUPAC name is but-2-enedioic acid;4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine.
| Compound Name | but-2-enedioic acid;4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 67451086 |
| Molecular Formula | C13H18N4O7 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | but-2-enedioic acid;4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine |
| SMILES | O=C(O)C=CC(=O)O.O=[N+]([O-])c1cncn1CCN1CCOCC1 |
| InChI | InChI=1S/C9H14N4O3.C4H4O4/c14-13(15)9-7-10-8-12(9)2-1-11-3-5-16-6-4-11;5-3(6)1-2-4(7)8/h7-8H,1-6H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | HIMDIGOBZNJDDV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|