C15H13F2N5S — CID 67452915
2-(2,4-difluorophenyl)-4-(8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-1,3-thiazole (PubChem CID 67452915) has the molecular formula C15H13F2N5S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-4-(8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-1,3-thiazole.
| Compound Name | 2-(2,4-difluorophenyl)-4-(8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 67452915 |
| Molecular Formula | C15H13F2N5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)-4-(8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-1,3-thiazole |
| SMILES | CC1NCCn2c(-c3csc(-c4ccc(F)cc4F)n3)nnc21 |
| InChI | InChI=1S/C15H13F2N5S/c1-8-13-20-21-14(22(13)5-4-18-8)12-7-23-15(19-12)10-3-2-9(16)6-11(10)17/h2-3,6-8,18H,4-5H2,1H3 |
| InChIKey | DVFQICYWNKFVGW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |