C21H17FN6O — CID 67452929
3-[6-[(2-cyano-1-pyridin-2-ylcyclobutyl)amino]pyridazin-3-yl]-4-fluorobenzamide (PubChem CID 67452929) has the molecular formula C21H17FN6O and a molecular weight of 388.41 g/mol. Its IUPAC name is 3-[6-[(2-cyano-1-pyridin-2-ylcyclobutyl)amino]pyridazin-3-yl]-4-fluorobenzamide.
| Compound Name | 3-[6-[(2-cyano-1-pyridin-2-ylcyclobutyl)amino]pyridazin-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 67452929 |
| Molecular Formula | C21H17FN6O |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-[6-[(2-cyano-1-pyridin-2-ylcyclobutyl)amino]pyridazin-3-yl]-4-fluorobenzamide |
| SMILES | N#CC1CCC1(Nc1ccc(-c2cc(C(N)=O)ccc2F)nn1)c1ccccn1 |
| InChI | InChI=1S/C21H17FN6O/c22-16-5-4-13(20(24)29)11-15(16)17-6-7-19(28-27-17)26-21(9-8-14(21)12-23)18-3-1-2-10-25-18/h1-7,10-11,14H,8-9H2,(H2,24,29)(H,26,28) |
| InChIKey | JVQMSXSSQLAMFI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |