C22H24FN5O2 — CID 88899648
3-[6-[[1-[(3Z,5E)-6-amino-5-methoxyhexa-1,3,5-trien-2-yl]cyclobutyl]amino]pyridazin-3-yl]-4-fluorobenzamide (PubChem CID 88899648) has the molecular formula C22H24FN5O2 and a molecular weight of 409.47 g/mol. Its IUPAC name is 3-[6-[[1-[(3Z,5E)-6-amino-5-methoxyhexa-1,3,5-trien-2-yl]cyclobutyl]amino]pyridazin-3-yl]-4-fluorobenzamide.
| Compound Name | 3-[6-[[1-[(3Z,5E)-6-amino-5-methoxyhexa-1,3,5-trien-2-yl]cyclobutyl]amino]pyridazin-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 88899648 |
| Molecular Formula | C22H24FN5O2 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-[6-[[1-[(3Z,5E)-6-amino-5-methoxyhexa-1,3,5-trien-2-yl]cyclobutyl]amino]pyridazin-3-yl]-4-fluorobenzamide |
| SMILES | C=C(/C=C\C(=C/N)OC)C1(Nc2ccc(-c3cc(C(N)=O)ccc3F)nn2)CCC1 |
| InChI | InChI=1S/C22H24FN5O2/c1-14(4-6-16(13-24)30-2)22(10-3-11-22)26-20-9-8-19(27-28-20)17-12-15(21(25)29)5-7-18(17)23/h4-9,12-13H,1,3,10-11,24H2,2H3,(H2,25,29)(H,26,28)/b6-4-,16-13+ |
| InChIKey | JSRHPOGZSPXUQK-UEWGSTKPSA-N |
| XLogP | 3.28 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|