C13H34N4OSi2 — CID 67453012
N'-[[2-[(2-aminoethylamino)methyl]-2,3,6,6-tetramethyloxadisilinan-3-yl]methyl]ethane-1,2-diamine (PubChem CID 67453012) has the molecular formula C13H34N4OSi2 and a molecular weight of 318.61 g/mol. Its IUPAC name is N'-[[2-[(2-aminoethylamino)methyl]-2,3,6,6-tetramethyloxadisilinan-3-yl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[2-[(2-aminoethylamino)methyl]-2,3,6,6-tetramethyloxadisilinan-3-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 67453012 |
| Molecular Formula | C13H34N4OSi2 |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N'-[[2-[(2-aminoethylamino)methyl]-2,3,6,6-tetramethyloxadisilinan-3-yl]methyl]ethane-1,2-diamine |
| SMILES | CC1(C)CC[Si](C)(CNCCN)[Si](C)(CNCCN)O1 |
| InChI | InChI=1S/C13H34N4OSi2/c1-13(2)5-10-19(3,11-16-8-6-14)20(4,18-13)12-17-9-7-15/h16-17H,5-12,14-15H2,1-4H3 |
| InChIKey | ZYAISMCMVJGKSA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|