C13H12N2O5 — CID 6745359
[3,5-bis(hydroxyimino)-4-oxocyclohexyl] benzoate (PubChem CID 6745359) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is [3,5-bis(hydroxyimino)-4-oxocyclohexyl] benzoate.
| Compound Name | [3,5-bis(hydroxyimino)-4-oxocyclohexyl] benzoate |
|---|---|
| PubChem CID | 6745359 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [3,5-bis(hydroxyimino)-4-oxocyclohexyl] benzoate |
| SMILES | O=C1C(=NO)CC(OC(=O)c2ccccc2)CC1=NO |
| InChI | InChI=1S/C13H12N2O5/c16-12-10(14-18)6-9(7-11(12)15-19)20-13(17)8-4-2-1-3-5-8/h1-5,9,18-19H,6-7H2 |
| InChIKey | MZUAYSDBSKYJKQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|