C20H23F2N7O2 — CID 67455984
2-[[5-[(3S)-3-(4,4-difluoropiperidin-1-yl)pyrrolidin-1-yl]triazolo[4,5-b]pyrazin-3-yl]methyl]benzene-1,4-diol (PubChem CID 67455984) has the molecular formula C20H23F2N7O2 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[[5-[(3S)-3-(4,4-difluoropiperidin-1-yl)pyrrolidin-1-yl]triazolo[4,5-b]pyrazin-3-yl]methyl]benzene-1,4-diol.
| Compound Name | 2-[[5-[(3S)-3-(4,4-difluoropiperidin-1-yl)pyrrolidin-1-yl]triazolo[4,5-b]pyrazin-3-yl]methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 67455984 |
| Molecular Formula | C20H23F2N7O2 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-[[5-[(3S)-3-(4,4-difluoropiperidin-1-yl)pyrrolidin-1-yl]triazolo[4,5-b]pyrazin-3-yl]methyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(Cn2nnc3ncc(N4CC[C@H](N5CCC(F)(F)CC5)C4)nc32)c1 |
| InChI | InChI=1S/C20H23F2N7O2/c21-20(22)4-7-27(8-5-20)14-3-6-28(12-14)17-10-23-18-19(24-17)29(26-25-18)11-13-9-15(30)1-2-16(13)31/h1-2,9-10,14,30-31H,3-8,11-12H2/t14-/m0/s1 |
| InChIKey | OXXGUDOUNHFIFS-AWEZNQCLSA-N |
| XLogP | 1.99 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|