C15H12F2O — CID 67459044
2-[[4-(2,2-difluoroethenyl)phenyl]methyl]phenol (PubChem CID 67459044) has the molecular formula C15H12F2O and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-[[4-(2,2-difluoroethenyl)phenyl]methyl]phenol.
| Compound Name | 2-[[4-(2,2-difluoroethenyl)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 67459044 |
| Molecular Formula | C15H12F2O |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-[[4-(2,2-difluoroethenyl)phenyl]methyl]phenol |
| SMILES | Oc1ccccc1Cc1ccc(C=C(F)F)cc1 |
| InChI | InChI=1S/C15H12F2O/c16-15(17)10-12-7-5-11(6-8-12)9-13-3-1-2-4-14(13)18/h1-8,10,18H,9H2 |
| InChIKey | GAWPNNABDLGVJL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |