C10H14ClN3O4 — CID 67463429
4-amino-6-(chloromethyl)-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 67463429) has the molecular formula C10H14ClN3O4 and a molecular weight of 275.69 g/mol. Its IUPAC name is 4-amino-6-(chloromethyl)-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-6-(chloromethyl)-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 67463429 |
| Molecular Formula | C10H14ClN3O4 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-amino-6-(chloromethyl)-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1cc(CCl)n([C@@H]2O[C@H](CO)CC2O)c(=O)n1 |
| InChI | InChI=1S/C10H14ClN3O4/c11-3-5-1-8(12)13-10(17)14(5)9-7(16)2-6(4-15)18-9/h1,6-7,9,15-16H,2-4H2,(H2,12,13,17)/t6-,7?,9+/m0/s1 |
| InChIKey | KKNLRVCDDWPTEX-JFOAVASISA-N |
| XLogP | -0.80 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|