C14H21FN2O4S — CID 67466787
(R)-N-[(2S)-2-(2-fluoro-5-nitrophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 67466787) has the molecular formula C14H21FN2O4S and a molecular weight of 332.40 g/mol. Its IUPAC name is (R)-N-[(2S)-2-(2-fluoro-5-nitrophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2S)-2-(2-fluoro-5-nitrophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67466787 |
| Molecular Formula | C14H21FN2O4S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (R)-N-[(2S)-2-(2-fluoro-5-nitrophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@](C)(CCO)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C14H21FN2O4S/c1-13(2,3)22(21)16-14(4,7-8-18)11-9-10(17(19)20)5-6-12(11)15/h5-6,9,16,18H,7-8H2,1-4H3/t14-,22+/m0/s1 |
| InChIKey | WHADNYSELSCSSP-RCDICMHDSA-N |
| XLogP | 2.38 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|