C22H29N5O6S — CID 67469857
hexyl N-[7-ethyl-6-(2-methylpyrazol-3-yl)-1-methylsulfonyl-2,4-dioxoquinazolin-3-yl]carbamate (PubChem CID 67469857) has the molecular formula C22H29N5O6S and a molecular weight of 491.57 g/mol. Its IUPAC name is hexyl N-[7-ethyl-6-(2-methylpyrazol-3-yl)-1-methylsulfonyl-2,4-dioxoquinazolin-3-yl]carbamate.
| Compound Name | hexyl N-[7-ethyl-6-(2-methylpyrazol-3-yl)-1-methylsulfonyl-2,4-dioxoquinazolin-3-yl]carbamate |
|---|---|
| PubChem CID | 67469857 |
| Molecular Formula | C22H29N5O6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | hexyl N-[7-ethyl-6-(2-methylpyrazol-3-yl)-1-methylsulfonyl-2,4-dioxoquinazolin-3-yl]carbamate |
| SMILES | CCCCCCOC(=O)Nn1c(=O)c2cc(-c3ccnn3C)c(CC)cc2n(S(C)(=O)=O)c1=O |
| InChI | InChI=1S/C22H29N5O6S/c1-5-7-8-9-12-33-21(29)24-26-20(28)17-14-16(18-10-11-23-25(18)3)15(6-2)13-19(17)27(22(26)30)34(4,31)32/h10-11,13-14H,5-9,12H2,1-4H3,(H,24,29) |
| InChIKey | DNSCASYIIFAMJD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|