C21H27N5O6S — CID 54755590
pentyl N-[7-ethyl-6-(2-methylpyrazol-3-yl)-2,4-dioxo-1H-quinazolin-3-yl]-N-methylsulfonylcarbamate (PubChem CID 54755590) has the molecular formula C21H27N5O6S and a molecular weight of 477.54 g/mol. Its IUPAC name is pentyl N-[7-ethyl-6-(2-methylpyrazol-3-yl)-2,4-dioxo-1H-quinazolin-3-yl]-N-methylsulfonylcarbamate.
| Compound Name | pentyl N-[7-ethyl-6-(2-methylpyrazol-3-yl)-2,4-dioxo-1H-quinazolin-3-yl]-N-methylsulfonylcarbamate |
|---|---|
| PubChem CID | 54755590 |
| Molecular Formula | C21H27N5O6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | pentyl N-[7-ethyl-6-(2-methylpyrazol-3-yl)-2,4-dioxo-1H-quinazolin-3-yl]-N-methylsulfonylcarbamate |
| SMILES | CCCCCOC(=O)N(n1c(=O)[nH]c2cc(CC)c(-c3ccnn3C)cc2c1=O)S(C)(=O)=O |
| InChI | InChI=1S/C21H27N5O6S/c1-5-7-8-11-32-21(29)26(33(4,30)31)25-19(27)16-13-15(18-9-10-22-24(18)3)14(6-2)12-17(16)23-20(25)28/h9-10,12-13H,5-8,11H2,1-4H3,(H,23,28) |
| InChIKey | RKGWTHAEKFGVQY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|