C20H24F3N3O6S — CID 67469912
N-[2,4-dioxo-6-[(2R)-oxolan-2-yl]-7-(trifluoromethyl)-1H-quinazolin-3-yl]-N-methylsulfonylhexanamide (PubChem CID 67469912) has the molecular formula C20H24F3N3O6S and a molecular weight of 491.49 g/mol. Its IUPAC name is N-[2,4-dioxo-6-[(2R)-oxolan-2-yl]-7-(trifluoromethyl)-1H-quinazolin-3-yl]-N-methylsulfonylhexanamide.
| Compound Name | N-[2,4-dioxo-6-[(2R)-oxolan-2-yl]-7-(trifluoromethyl)-1H-quinazolin-3-yl]-N-methylsulfonylhexanamide |
|---|---|
| PubChem CID | 67469912 |
| Molecular Formula | C20H24F3N3O6S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-[2,4-dioxo-6-[(2R)-oxolan-2-yl]-7-(trifluoromethyl)-1H-quinazolin-3-yl]-N-methylsulfonylhexanamide |
| SMILES | CCCCCC(=O)N(n1c(=O)[nH]c2cc(C(F)(F)F)c([C@H]3CCCO3)cc2c1=O)S(C)(=O)=O |
| InChI | InChI=1S/C20H24F3N3O6S/c1-3-4-5-8-17(27)26(33(2,30)31)25-18(28)13-10-12(16-7-6-9-32-16)14(20(21,22)23)11-15(13)24-19(25)29/h10-11,16H,3-9H2,1-2H3,(H,24,29)/t16-/m1/s1 |
| InChIKey | JSITWNIQEYQPOS-MRXNPFEDSA-N |
| XLogP | 2.56 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|