C19H24F3N3O7S — CID 54756305
butyl N-[6-(1-methoxypropyl)-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]-N-methylsulfonylcarbamate (PubChem CID 54756305) has the molecular formula C19H24F3N3O7S and a molecular weight of 495.48 g/mol. Its IUPAC name is butyl N-[6-(1-methoxypropyl)-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]-N-methylsulfonylcarbamate.
| Compound Name | butyl N-[6-(1-methoxypropyl)-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]-N-methylsulfonylcarbamate |
|---|---|
| PubChem CID | 54756305 |
| Molecular Formula | C19H24F3N3O7S |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | butyl N-[6-(1-methoxypropyl)-2,4-dioxo-7-(trifluoromethyl)-1H-quinazolin-3-yl]-N-methylsulfonylcarbamate |
| SMILES | CCCCOC(=O)N(n1c(=O)[nH]c2cc(C(F)(F)F)c(C(CC)OC)cc2c1=O)S(C)(=O)=O |
| InChI | InChI=1S/C19H24F3N3O7S/c1-5-7-8-32-18(28)25(33(4,29)30)24-16(26)12-9-11(15(6-2)31-3)13(19(20,21)22)10-14(12)23-17(24)27/h9-10,15H,5-8H2,1-4H3,(H,23,27) |
| InChIKey | JVAKPFMENMZQBU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|