C18H23N3O2 — CID 67475571
benzyl N-[(4R)-1-propyl-4,5,6,7-tetrahydroindazol-4-yl]carbamate (PubChem CID 67475571) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is benzyl N-[(4R)-1-propyl-4,5,6,7-tetrahydroindazol-4-yl]carbamate.
| Compound Name | benzyl N-[(4R)-1-propyl-4,5,6,7-tetrahydroindazol-4-yl]carbamate |
|---|---|
| PubChem CID | 67475571 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | benzyl N-[(4R)-1-propyl-4,5,6,7-tetrahydroindazol-4-yl]carbamate |
| SMILES | CCCn1ncc2c1CCC[C@H]2NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23N3O2/c1-2-11-21-17-10-6-9-16(15(17)12-19-21)20-18(22)23-13-14-7-4-3-5-8-14/h3-5,7-8,12,16H,2,6,9-11,13H2,1H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | AYZSRNAHAXRDQI-MRXNPFEDSA-N |
| XLogP | 3.60 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |