C18H27NO4S — CID 67475628
3-[4-hydroxypentyl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 67475628) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is 3-[4-hydroxypentyl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 3-[4-hydroxypentyl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67475628 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-[4-hydroxypentyl-(4-methylcyclohexanecarbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | CC(O)CCCN(C(=O)C1CCC(C)CC1)c1ccsc1C(=O)O |
| InChI | InChI=1S/C18H27NO4S/c1-12-5-7-14(8-6-12)17(21)19(10-3-4-13(2)20)15-9-11-24-16(15)18(22)23/h9,11-14,20H,3-8,10H2,1-2H3,(H,22,23) |
| InChIKey | YZSSTUXDOBVYJW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |