About 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol
2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol (PubChem CID 67477541) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol.
Analyze 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol (CID 67477541) is 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol is CC1=CC(CO)=C(O)C(CO)C1.
What is the InChIKey of 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol?
The InChIKey is RDDQQSHJSDIMFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-6-2-7(4-10)9(12)8(3-6)5-11/h2,8,10-12H,3-5H2,1H3.
What are the key properties of 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol?
2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol has a molecular weight of 170.21 g/mol, XLogP of 0.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(hydroxymethyl)-4-methylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 67477541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).