C26H22N6O5 — CID 67478522
(2S)-4-benzoyl-15-(2,4-dimethoxypyrimidin-5-yl)-4,7,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11(16),12,14-tetraene-8,9-dione (PubChem CID 67478522) has the molecular formula C26H22N6O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is (2S)-4-benzoyl-15-(2,4-dimethoxypyrimidin-5-yl)-4,7,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11(16),12,14-tetraene-8,9-dione.
| Compound Name | (2S)-4-benzoyl-15-(2,4-dimethoxypyrimidin-5-yl)-4,7,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11(16),12,14-tetraene-8,9-dione |
|---|---|
| PubChem CID | 67478522 |
| Molecular Formula | C26H22N6O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (2S)-4-benzoyl-15-(2,4-dimethoxypyrimidin-5-yl)-4,7,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11(16),12,14-tetraene-8,9-dione |
| SMILES | COc1ncc(-c2nccc3c4c([nH]c23)[C@@H]2CN(C(=O)c3ccccc3)CCN2C(=O)C4=O)c(OC)n1 |
| InChI | InChI=1S/C26H22N6O5/c1-36-23-16(12-28-26(30-23)37-2)19-20-15(8-9-27-19)18-21(29-20)17-13-31(10-11-32(17)25(35)22(18)33)24(34)14-6-4-3-5-7-14/h3-9,12,17,29H,10-11,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | MGUIPELUHBOOPI-KRWDZBQOSA-N |
| XLogP | 2.26 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|