C23H20Cl2N2O4S — CID 67481295
2-[3-(3,5-dichlorobenzoyl)-5-methylphenyl]-N-(2-methyl-4-sulfamoylphenyl)acetamide (PubChem CID 67481295) has the molecular formula C23H20Cl2N2O4S and a molecular weight of 491.40 g/mol. Its IUPAC name is 2-[3-(3,5-dichlorobenzoyl)-5-methylphenyl]-N-(2-methyl-4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3-(3,5-dichlorobenzoyl)-5-methylphenyl]-N-(2-methyl-4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 67481295 |
| Molecular Formula | C23H20Cl2N2O4S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 2-[3-(3,5-dichlorobenzoyl)-5-methylphenyl]-N-(2-methyl-4-sulfamoylphenyl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2ccc(S(N)(=O)=O)cc2C)cc(C(=O)c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C23H20Cl2N2O4S/c1-13-5-15(8-16(6-13)23(29)17-10-18(24)12-19(25)11-17)9-22(28)27-21-4-3-20(7-14(21)2)32(26,30)31/h3-8,10-12H,9H2,1-2H3,(H,27,28)(H2,26,30,31) |
| InChIKey | LILUDAIUXQITLM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |