C24H30BrNO4 — CID 67484389
methyl 3-[[4-[(1R)-1-(4-bromophenyl)-7-hydroxyheptyl]benzoyl]amino]propanoate (PubChem CID 67484389) has the molecular formula C24H30BrNO4 and a molecular weight of 476.41 g/mol. Its IUPAC name is methyl 3-[[4-[(1R)-1-(4-bromophenyl)-7-hydroxyheptyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[(1R)-1-(4-bromophenyl)-7-hydroxyheptyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 67484389 |
| Molecular Formula | C24H30BrNO4 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | methyl 3-[[4-[(1R)-1-(4-bromophenyl)-7-hydroxyheptyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc([C@@H](CCCCCCO)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H30BrNO4/c1-30-23(28)15-16-26-24(29)20-9-7-18(8-10-20)22(6-4-2-3-5-17-27)19-11-13-21(25)14-12-19/h7-14,22,27H,2-6,15-17H2,1H3,(H,26,29)/t22-/m1/s1 |
| InChIKey | FTKANRBDVYWNGY-JOCHJYFZSA-N |
| XLogP | 4.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|