C23H26BrNO3 — CID 67485995
methyl 3-[[4-[5-(4-bromophenyl)-3-methylpent-4-enyl]benzoyl]amino]propanoate (PubChem CID 67485995) has the molecular formula C23H26BrNO3 and a molecular weight of 444.37 g/mol. Its IUPAC name is methyl 3-[[4-[5-(4-bromophenyl)-3-methylpent-4-enyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[5-(4-bromophenyl)-3-methylpent-4-enyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 67485995 |
| Molecular Formula | C23H26BrNO3 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | methyl 3-[[4-[5-(4-bromophenyl)-3-methylpent-4-enyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(CCC(C)C=Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H26BrNO3/c1-17(4-6-19-9-13-21(24)14-10-19)3-5-18-7-11-20(12-8-18)23(27)25-16-15-22(26)28-2/h4,6-14,17H,3,5,15-16H2,1-2H3,(H,25,27) |
| InChIKey | WENGBMRTIRNLQM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |