1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid

C14H13F2NO2 — CID 67486993

IUPAC1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid
SMILESCCc1cc(C(=O)O)n(Cc2ccc(F)cc2F)c1
InChIInChI=1S/C14H13F2NO2/c1-2-9-5-13(14(18)19)17(7-9)8-10-3-4-11(15)6-12(10)16/h3-7H,2,8H2,1H3,(H,18,19)
InChIKeyKKQBUPDNBZOTGO-UHFFFAOYSA-N
MW265.26 g/mol
LogP3.08
Rot. Bonds4

About 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid

1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid (PubChem CID 67486993) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid.

Molecular Properties

Compound Name1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid
PubChem CID67486993
Molecular FormulaC14H13F2NO2
Molecular Weight265.26 g/mol
Exact Mass265.09
IUPAC Name1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid
SMILESCCc1cc(C(=O)O)n(Cc2ccc(F)cc2F)c1
InChIInChI=1S/C14H13F2NO2/c1-2-9-5-13(14(18)19)17(7-9)8-10-3-4-11(15)6-12(10)16/h3-7H,2,8H2,1H3,(H,18,19)
InChIKeyKKQBUPDNBZOTGO-UHFFFAOYSA-N
XLogP3.08
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.26
LogP ≤ 53.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid?
The IUPAC name of 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid (CID 67486993) is 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid.
What is the SMILES notation for 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid?
The canonical SMILES for 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid is CCc1cc(C(=O)O)n(Cc2ccc(F)cc2F)c1.
What is the InChIKey of 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid?
The InChIKey is KKQBUPDNBZOTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO2/c1-2-9-5-13(14(18)19)17(7-9)8-10-3-4-11(15)6-12(10)16/h3-7H,2,8H2,1H3,(H,18,19).
What are the key properties of 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid?
1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid has a molecular weight of 265.26 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-difluorophenyl)methyl]-4-ethylpyrrole-2-carboxylic acid is sourced from PubChem (CID 67486993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).