C28H26Cl2N6O2 — CID 67489725
4-[[5-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrazol-1-yl]methyl]-N-[2-(methyldiazenyl)-2-methyliminoethyl]benzamide (PubChem CID 67489725) has the molecular formula C28H26Cl2N6O2 and a molecular weight of 549.46 g/mol. Its IUPAC name is 4-[[5-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrazol-1-yl]methyl]-N-[2-(methyldiazenyl)-2-methyliminoethyl]benzamide.
| Compound Name | 4-[[5-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrazol-1-yl]methyl]-N-[2-(methyldiazenyl)-2-methyliminoethyl]benzamide |
|---|---|
| PubChem CID | 67489725 |
| Molecular Formula | C28H26Cl2N6O2 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 4-[[5-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)pyrazol-1-yl]methyl]-N-[2-(methyldiazenyl)-2-methyliminoethyl]benzamide |
| SMILES | C/N=C(CNC(=O)c1ccc(Cn2nc(-c3ccc(OC)cc3)cc2-c2ccc(Cl)c(Cl)c2)cc1)\N=N\C |
| InChI | InChI=1S/C28H26Cl2N6O2/c1-31-27(34-32-2)16-33-28(37)20-6-4-18(5-7-20)17-36-26(21-10-13-23(29)24(30)14-21)15-25(35-36)19-8-11-22(38-3)12-9-19/h4-15H,16-17H2,1-3H3,(H,33,37)/b31-27-,34-32+ |
| InChIKey | VYKRGSBFLZYKKP-CQCFJNRKSA-N |
| XLogP | 6.42 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|