C23H16Cl4N2 — CID 17025672
3,5-bis(3,4-dichlorophenyl)-1-[(4-methylphenyl)methyl]pyrazole (PubChem CID 17025672) has the molecular formula C23H16Cl4N2 and a molecular weight of 462.21 g/mol. Its IUPAC name is 3,5-bis(3,4-dichlorophenyl)-1-[(4-methylphenyl)methyl]pyrazole.
| Compound Name | 3,5-bis(3,4-dichlorophenyl)-1-[(4-methylphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 17025672 |
| Molecular Formula | C23H16Cl4N2 |
| Molecular Weight | 462.21 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 3,5-bis(3,4-dichlorophenyl)-1-[(4-methylphenyl)methyl]pyrazole |
| SMILES | Cc1ccc(Cn2nc(-c3ccc(Cl)c(Cl)c3)cc2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H16Cl4N2/c1-14-2-4-15(5-3-14)13-29-23(17-7-9-19(25)21(27)11-17)12-22(28-29)16-6-8-18(24)20(26)10-16/h2-12H,13H2,1H3 |
| InChIKey | CTMCCEGPIBUERN-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.21 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |