C27H22Cl2F3N7O2 — CID 87419813
N-[(2Z)-2-amino-2-[(methylideneamino)hydrazinylidene]ethyl]-4-[[3-(3,5-dichlorophenyl)-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzamide (PubChem CID 87419813) has the molecular formula C27H22Cl2F3N7O2 and a molecular weight of 604.42 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-[(methylideneamino)hydrazinylidene]ethyl]-4-[[3-(3,5-dichlorophenyl)-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzamide.
| Compound Name | N-[(2Z)-2-amino-2-[(methylideneamino)hydrazinylidene]ethyl]-4-[[3-(3,5-dichlorophenyl)-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 87419813 |
| Molecular Formula | C27H22Cl2F3N7O2 |
| Molecular Weight | 604.42 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | N-[(2Z)-2-amino-2-[(methylideneamino)hydrazinylidene]ethyl]-4-[[3-(3,5-dichlorophenyl)-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzamide |
| SMILES | C=NN/N=C(\N)CNC(=O)c1ccc(Cn2nc(-c3cc(Cl)cc(Cl)c3)cc2-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H22Cl2F3N7O2/c1-34-38-36-25(33)14-35-26(40)18-4-2-16(3-5-18)15-39-24(17-6-8-22(9-7-17)41-27(30,31)32)13-23(37-39)19-10-20(28)12-21(29)11-19/h2-13,38H,1,14-15H2,(H2,33,36)(H,35,40) |
| InChIKey | QCXLFBSOFOKHHB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|