C28H27ClF3N7O2 — CID 87419765
N-[(2Z)-2-amino-2-(aminohydrazinylidene)ethyl]-4-[[3-[1-(4-chlorophenyl)ethyl]-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzamide (PubChem CID 87419765) has the molecular formula C28H27ClF3N7O2 and a molecular weight of 586.02 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-(aminohydrazinylidene)ethyl]-4-[[3-[1-(4-chlorophenyl)ethyl]-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzamide.
| Compound Name | N-[(2Z)-2-amino-2-(aminohydrazinylidene)ethyl]-4-[[3-[1-(4-chlorophenyl)ethyl]-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 87419765 |
| Molecular Formula | C28H27ClF3N7O2 |
| Molecular Weight | 586.02 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | N-[(2Z)-2-amino-2-(aminohydrazinylidene)ethyl]-4-[[3-[1-(4-chlorophenyl)ethyl]-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzamide |
| SMILES | CC(c1ccc(Cl)cc1)c1cc(-c2ccc(OC(F)(F)F)cc2)n(Cc2ccc(C(=O)NC/C(N)=N/NN)cc2)n1 |
| InChI | InChI=1S/C28H27ClF3N7O2/c1-17(19-6-10-22(29)11-7-19)24-14-25(20-8-12-23(13-9-20)41-28(30,31)32)39(37-24)16-18-2-4-21(5-3-18)27(40)35-15-26(33)36-38-34/h2-14,17,38H,15-16,34H2,1H3,(H2,33,36)(H,35,40) |
| InChIKey | ZNEPGYLOAJJHBH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 132.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.02 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|