C30H27ClF2IN3O5 — CID 162550050
3-[[4-[[5-[1-(4-chlorophenyl)-2-iodoethyl]-3-[4-(1,1-difluoroethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]-2-hydroxypropanoic acid (PubChem CID 162550050) has the molecular formula C30H27ClF2IN3O5 and a molecular weight of 709.91 g/mol. Its IUPAC name is 3-[[4-[[5-[1-(4-chlorophenyl)-2-iodoethyl]-3-[4-(1,1-difluoroethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[[4-[[5-[1-(4-chlorophenyl)-2-iodoethyl]-3-[4-(1,1-difluoroethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 162550050 |
| Molecular Formula | C30H27ClF2IN3O5 |
| Molecular Weight | 709.91 g/mol |
| Exact Mass | 709.07 |
| IUPAC Name | 3-[[4-[[5-[1-(4-chlorophenyl)-2-iodoethyl]-3-[4-(1,1-difluoroethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
| SMILES | CC(F)(F)Oc1ccc(-c2cc(C(CI)c3ccc(Cl)cc3)n(Cc3ccc(C(=O)NCC(O)C(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C30H27ClF2IN3O5/c1-30(32,33)42-23-12-8-20(9-13-23)25-14-26(24(15-34)19-6-10-22(31)11-7-19)37(36-25)17-18-2-4-21(5-3-18)28(39)35-16-27(38)29(40)41/h2-14,24,27,38H,15-17H2,1H3,(H,35,39)(H,40,41) |
| InChIKey | ATQGFDDZNOWCRY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.91 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|