C12H12N2O4S — CID 674924
ethyl 2-[2-(furan-2-carbonylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 674924) has the molecular formula C12H12N2O4S and a molecular weight of 280.30 g/mol. Its IUPAC name is ethyl 2-[2-(furan-2-carbonylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(furan-2-carbonylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 674924 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | ethyl 2-[2-(furan-2-carbonylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C12H12N2O4S/c1-2-17-10(15)6-8-7-19-12(13-8)14-11(16)9-4-3-5-18-9/h3-5,7H,2,6H2,1H3,(H,13,14,16) |
| InChIKey | VPHWFQOJVRPSKQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |