2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid

C14H24N2O3 — CID 67493181

IUPAC2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid
SMILESO=C(C1CCCCCC1)C1CNCCCN1C(=O)O
InChIInChI=1S/C14H24N2O3/c17-13(11-6-3-1-2-4-7-11)12-10-15-8-5-9-16(12)14(18)19/h11-12,15H,1-10H2,(H,18,19)
InChIKeyNAEXMGCSOWKTIL-UHFFFAOYSA-N
MW268.36 g/mol
LogP1.87
Rot. Bonds2

About 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid

2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid (PubChem CID 67493181) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid.

Molecular Properties

Compound Name2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid
PubChem CID67493181
Molecular FormulaC14H24N2O3
Molecular Weight268.36 g/mol
Exact Mass268.18
IUPAC Name2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid
SMILESO=C(C1CCCCCC1)C1CNCCCN1C(=O)O
InChIInChI=1S/C14H24N2O3/c17-13(11-6-3-1-2-4-7-11)12-10-15-8-5-9-16(12)14(18)19/h11-12,15H,1-10H2,(H,18,19)
InChIKeyNAEXMGCSOWKTIL-UHFFFAOYSA-N
XLogP1.87
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.36
LogP ≤ 51.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid?
The IUPAC name of 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid (CID 67493181) is 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid.
What is the SMILES notation for 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid?
The canonical SMILES for 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid is O=C(C1CCCCCC1)C1CNCCCN1C(=O)O.
What is the InChIKey of 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid?
The InChIKey is NAEXMGCSOWKTIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c17-13(11-6-3-1-2-4-7-11)12-10-15-8-5-9-16(12)14(18)19/h11-12,15H,1-10H2,(H,18,19).
What are the key properties of 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid?
2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid has a molecular weight of 268.36 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cycloheptanecarbonyl)-1,4-diazepane-1-carboxylic acid is sourced from PubChem (CID 67493181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).