2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid

C12H20N2O3 — CID 67493440

IUPAC2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid
SMILESO=C(C1CCCC1)C1CNCCCN1C(=O)O
InChIInChI=1S/C12H20N2O3/c15-11(9-4-1-2-5-9)10-8-13-6-3-7-14(10)12(16)17/h9-10,13H,1-8H2,(H,16,17)
InChIKeyLCALOGPVSMJSGE-UHFFFAOYSA-N
MW240.30 g/mol
LogP1.09
Rot. Bonds2

About 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid

2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid (PubChem CID 67493440) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid.

Molecular Properties

Compound Name2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid
PubChem CID67493440
Molecular FormulaC12H20N2O3
Molecular Weight240.30 g/mol
Exact Mass240.15
IUPAC Name2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid
SMILESO=C(C1CCCC1)C1CNCCCN1C(=O)O
InChIInChI=1S/C12H20N2O3/c15-11(9-4-1-2-5-9)10-8-13-6-3-7-14(10)12(16)17/h9-10,13H,1-8H2,(H,16,17)
InChIKeyLCALOGPVSMJSGE-UHFFFAOYSA-N
XLogP1.09
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.30
LogP ≤ 51.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid?
The IUPAC name of 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid (CID 67493440) is 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid.
What is the SMILES notation for 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid?
The canonical SMILES for 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid is O=C(C1CCCC1)C1CNCCCN1C(=O)O.
What is the InChIKey of 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid?
The InChIKey is LCALOGPVSMJSGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3/c15-11(9-4-1-2-5-9)10-8-13-6-3-7-14(10)12(16)17/h9-10,13H,1-8H2,(H,16,17).
What are the key properties of 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid?
2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid has a molecular weight of 240.30 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentanecarbonyl)-1,4-diazepane-1-carboxylic acid is sourced from PubChem (CID 67493440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).