C26H36N6O2 — CID 67493925
N-[4-(diethylamino)butyl]-2-[[7-methoxy-3-[2-(methylamino)pyrimidin-4-yl]naphthalen-1-yl]amino]acetamide (PubChem CID 67493925) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[4-(diethylamino)butyl]-2-[[7-methoxy-3-[2-(methylamino)pyrimidin-4-yl]naphthalen-1-yl]amino]acetamide.
| Compound Name | N-[4-(diethylamino)butyl]-2-[[7-methoxy-3-[2-(methylamino)pyrimidin-4-yl]naphthalen-1-yl]amino]acetamide |
|---|---|
| PubChem CID | 67493925 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | N-[4-(diethylamino)butyl]-2-[[7-methoxy-3-[2-(methylamino)pyrimidin-4-yl]naphthalen-1-yl]amino]acetamide |
| SMILES | CCN(CC)CCCCNC(=O)CNc1cc(-c2ccnc(NC)n2)cc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H36N6O2/c1-5-32(6-2)14-8-7-12-28-25(33)18-30-24-16-20(23-11-13-29-26(27-3)31-23)15-19-9-10-21(34-4)17-22(19)24/h9-11,13,15-17,30H,5-8,12,14,18H2,1-4H3,(H,28,33)(H,27,29,31) |
| InChIKey | HOSZNNGAEJCFMQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|