C25H32N6O3 — CID 67493734
2-[[7-methoxy-3-[2-(methylamino)pyrimidin-4-yl]naphthalen-1-yl]amino]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 67493734) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-[[7-methoxy-3-[2-(methylamino)pyrimidin-4-yl]naphthalen-1-yl]amino]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[[7-methoxy-3-[2-(methylamino)pyrimidin-4-yl]naphthalen-1-yl]amino]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 67493734 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 2-[[7-methoxy-3-[2-(methylamino)pyrimidin-4-yl]naphthalen-1-yl]amino]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | CNc1nccc(-c2cc(NCC(=O)NCCCN3CCOCC3)c3cc(OC)ccc3c2)n1 |
| InChI | InChI=1S/C25H32N6O3/c1-26-25-28-8-6-22(30-25)19-14-18-4-5-20(33-2)16-21(18)23(15-19)29-17-24(32)27-7-3-9-31-10-12-34-13-11-31/h4-6,8,14-16,29H,3,7,9-13,17H2,1-2H3,(H,27,32)(H,26,28,30) |
| InChIKey | VVNHQBRWLGOEEW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|