C15H13ClN2O3 — CID 67500366
3-chlorobenzoic acid;7-hydroxy-3-methylpyrrolo[2,3-b]pyridine (PubChem CID 67500366) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is 3-chlorobenzoic acid;7-hydroxy-3-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 3-chlorobenzoic acid;7-hydroxy-3-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 67500366 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-chlorobenzoic acid;7-hydroxy-3-methylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1cnc2n(O)cccc1-2.O=C(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H8N2O.C7H5ClO2/c1-6-5-9-8-7(6)3-2-4-10(8)11;8-6-3-1-2-5(4-6)7(9)10/h2-5,11H,1H3;1-4H,(H,9,10) |
| InChIKey | CRONEMDHCOCQDE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|