C27H34Cl2N6O3S — CID 67506908
4-[[[1-(4-nitrophenyl)piperidin-4-yl]-[(3S,5S)-5-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]amino]methyl]benzonitrile;dihydrochloride (PubChem CID 67506908) has the molecular formula C27H34Cl2N6O3S and a molecular weight of 593.58 g/mol. Its IUPAC name is 4-[[[1-(4-nitrophenyl)piperidin-4-yl]-[(3S,5S)-5-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]amino]methyl]benzonitrile;dihydrochloride.
| Compound Name | 4-[[[1-(4-nitrophenyl)piperidin-4-yl]-[(3S,5S)-5-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]amino]methyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 67506908 |
| Molecular Formula | C27H34Cl2N6O3S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 4-[[[1-(4-nitrophenyl)piperidin-4-yl]-[(3S,5S)-5-(1,3-thiazolidine-3-carbonyl)pyrrolidin-3-yl]amino]methyl]benzonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1ccc(CN(C2CCN(c3ccc([N+](=O)[O-])cc3)CC2)[C@@H]2CN[C@H](C(=O)N3CCSC3)C2)cc1 |
| InChI | InChI=1S/C27H32N6O3S.2ClH/c28-16-20-1-3-21(4-2-20)18-32(25-15-26(29-17-25)27(34)31-13-14-37-19-31)23-9-11-30(12-10-23)22-5-7-24(8-6-22)33(35)36;;/h1-8,23,25-26,29H,9-15,17-19H2;2*1H/t25-,26-;;/m0../s1 |
| InChIKey | WXQZYKVLSFDOBO-HWTGJJCHSA-N |
| XLogP | 4.04 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|