C14H20N4OS — CID 67507092
[(2S,4S)-4-(4-aminoanilino)pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone (PubChem CID 67507092) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is [(2S,4S)-4-(4-aminoanilino)pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone.
| Compound Name | [(2S,4S)-4-(4-aminoanilino)pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 67507092 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [(2S,4S)-4-(4-aminoanilino)pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone |
| SMILES | Nc1ccc(N[C@@H]2CN[C@H](C(=O)N3CCSC3)C2)cc1 |
| InChI | InChI=1S/C14H20N4OS/c15-10-1-3-11(4-2-10)17-12-7-13(16-8-12)14(19)18-5-6-20-9-18/h1-4,12-13,16-17H,5-9,15H2/t12-,13-/m0/s1 |
| InChIKey | RQFDQPZZZNZLFI-STQMWFEESA-N |
| XLogP | 0.94 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|