C15H21N3OS — CID 72949229
[(2S,4S)-4-anilinopyrrolidin-2-yl]-thiomorpholin-4-ylmethanone (PubChem CID 72949229) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is [(2S,4S)-4-anilinopyrrolidin-2-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [(2S,4S)-4-anilinopyrrolidin-2-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 72949229 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [(2S,4S)-4-anilinopyrrolidin-2-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1C[C@H](Nc2ccccc2)CN1)N1CCSCC1 |
| InChI | InChI=1S/C15H21N3OS/c19-15(18-6-8-20-9-7-18)14-10-13(11-16-14)17-12-4-2-1-3-5-12/h1-5,13-14,16-17H,6-11H2/t13-,14-/m0/s1 |
| InChIKey | JUYSHDACZBFPID-KBPBESRZSA-N |
| XLogP | 1.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |