C42H52Cl2N4O6 — CID 67510954
bis[1-[2-[4-[2-(4-chlorophenyl)ethenyl]piperidin-1-yl]-2-oxoethyl]piperidin-3-yl] oxalate (PubChem CID 67510954) has the molecular formula C42H52Cl2N4O6 and a molecular weight of 779.81 g/mol. Its IUPAC name is bis[1-[2-[4-[2-(4-chlorophenyl)ethenyl]piperidin-1-yl]-2-oxoethyl]piperidin-3-yl] oxalate.
| Compound Name | bis[1-[2-[4-[2-(4-chlorophenyl)ethenyl]piperidin-1-yl]-2-oxoethyl]piperidin-3-yl] oxalate |
|---|---|
| PubChem CID | 67510954 |
| Molecular Formula | C42H52Cl2N4O6 |
| Molecular Weight | 779.81 g/mol |
| Exact Mass | 778.33 |
| IUPAC Name | bis[1-[2-[4-[2-(4-chlorophenyl)ethenyl]piperidin-1-yl]-2-oxoethyl]piperidin-3-yl] oxalate |
| SMILES | O=C(OC1CCCN(CC(=O)N2CCC(C=Cc3ccc(Cl)cc3)CC2)C1)C(=O)OC1CCCN(CC(=O)N2CCC(C=Cc3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C42H52Cl2N4O6/c43-35-13-9-31(10-14-35)5-7-33-17-23-47(24-18-33)39(49)29-45-21-1-3-37(27-45)53-41(51)42(52)54-38-4-2-22-46(28-38)30-40(50)48-25-19-34(20-26-48)8-6-32-11-15-36(44)16-12-32/h5-16,33-34,37-38H,1-4,17-30H2 |
| InChIKey | KDSZGNWHIFSHHR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.81 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|