C17H11N5S — CID 67517809
5-pyridin-3-yl-2-(6-pyrimidin-2-yl-2-pyridinyl)-1,3-thiazole (PubChem CID 67517809) has the molecular formula C17H11N5S and a molecular weight of 317.38 g/mol. Its IUPAC name is 5-pyridin-3-yl-2-(6-pyrimidin-2-yl-2-pyridinyl)-1,3-thiazole.
| Compound Name | 5-pyridin-3-yl-2-(6-pyrimidin-2-yl-2-pyridinyl)-1,3-thiazole |
|---|---|
| PubChem CID | 67517809 |
| Molecular Formula | C17H11N5S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 5-pyridin-3-yl-2-(6-pyrimidin-2-yl-2-pyridinyl)-1,3-thiazole |
| SMILES | c1cnc(-c2cccc(-c3ncc(-c4cccnc4)s3)n2)nc1 |
| InChI | InChI=1S/C17H11N5S/c1-5-13(16-19-8-3-9-20-16)22-14(6-1)17-21-11-15(23-17)12-4-2-7-18-10-12/h1-11H |
| InChIKey | HGRBIJNCRNGWRV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |