C31H26N2O5S — CID 67518074
3-[2-[(1R)-1-aminoprop-2-enyl]phenyl]-1-(benzenesulfonyl)-5-phenylmethoxyindole-2-carboxylic acid (PubChem CID 67518074) has the molecular formula C31H26N2O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is 3-[2-[(1R)-1-aminoprop-2-enyl]phenyl]-1-(benzenesulfonyl)-5-phenylmethoxyindole-2-carboxylic acid.
| Compound Name | 3-[2-[(1R)-1-aminoprop-2-enyl]phenyl]-1-(benzenesulfonyl)-5-phenylmethoxyindole-2-carboxylic acid |
|---|---|
| PubChem CID | 67518074 |
| Molecular Formula | C31H26N2O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 3-[2-[(1R)-1-aminoprop-2-enyl]phenyl]-1-(benzenesulfonyl)-5-phenylmethoxyindole-2-carboxylic acid |
| SMILES | C=C[C@@H](N)c1ccccc1-c1c(C(=O)O)n(S(=O)(=O)c2ccccc2)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C31H26N2O5S/c1-2-27(32)24-15-9-10-16-25(24)29-26-19-22(38-20-21-11-5-3-6-12-21)17-18-28(26)33(30(29)31(34)35)39(36,37)23-13-7-4-8-14-23/h2-19,27H,1,20,32H2,(H,34,35)/t27-/m1/s1 |
| InChIKey | BAILNCIWXBQDDL-HHHXNRCGSA-N |
| XLogP | 6.01 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|