C15H9NO6 — CID 67524541
1H-benzo[g]indole-2,7,9-tricarboxylic acid (PubChem CID 67524541) has the molecular formula C15H9NO6 and a molecular weight of 299.24 g/mol. Its IUPAC name is 1H-benzo[g]indole-2,7,9-tricarboxylic acid.
| Compound Name | 1H-benzo[g]indole-2,7,9-tricarboxylic acid |
|---|---|
| PubChem CID | 67524541 |
| Molecular Formula | C15H9NO6 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1H-benzo[g]indole-2,7,9-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c2c(ccc3cc(C(=O)O)[nH]c32)c1 |
| InChI | InChI=1S/C15H9NO6/c17-13(18)8-3-6-1-2-7-5-10(15(21)22)16-12(7)11(6)9(4-8)14(19)20/h1-5,16H,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | DLBFWVVEHGDQNO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |