C14H9N3O7 — CID 137120090
5-amino-4-hydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid (PubChem CID 137120090) has the molecular formula C14H9N3O7 and a molecular weight of 331.24 g/mol. Its IUPAC name is 5-amino-4-hydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid.
| Compound Name | 5-amino-4-hydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid |
|---|---|
| PubChem CID | 137120090 |
| Molecular Formula | C14H9N3O7 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 5-amino-4-hydroxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid |
| SMILES | Nc1c(O)c2cc(C(=O)O)nc2c2c(C(=O)O)cc(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C14H9N3O7/c15-8-10-7(3(12(19)20)1-5(17-10)13(21)22)9-4(11(8)18)2-6(16-9)14(23)24/h1-2,17-18H,15H2,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | AVWYMYNDUGUIRK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 186.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|