About 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid
2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid (PubChem CID 67534269) has the molecular formula C23H18Br2FNO5
and a molecular weight of 567.21 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid |
| PubChem CID | 67534269 |
| Molecular Formula | C23H18Br2FNO5 |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 564.95 |
| IUPAC Name | 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid |
| SMILES | CCN(C(=O)c1cc(Oc2c(Br)cc(CC(=O)O)cc2Br)ccc1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H18Br2FNO5/c1-2-27(15-5-3-14(26)4-6-15)23(31)17-12-16(7-8-20(17)28)32-22-18(24)9-13(10-19(22)25)11-21(29)30/h3-10,12,28H,2,11H2,1H3,(H,29,30) |
| InChIKey | NZGGHMFZDGHAIV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid?
The IUPAC name of 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid (CID 67534269) is 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid.
What is the SMILES notation for 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid?
The canonical SMILES for 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid is CCN(C(=O)c1cc(Oc2c(Br)cc(CC(=O)O)cc2Br)ccc1O)c1ccc(F)cc1.
What is the InChIKey of 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid?
The InChIKey is NZGGHMFZDGHAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18Br2FNO5/c1-2-27(15-5-3-14(26)4-6-15)23(31)17-12-16(7-8-20(17)28)32-22-18(24)9-13(10-19(22)25)11-21(29)30/h3-10,12,28H,2,11H2,1H3,(H,29,30).
What are the key properties of 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid?
2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid has a molecular weight of 567.21 g/mol, XLogP of 6.14, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dibromo-4-[3-[ethyl-(4-fluorophenyl)carbamoyl]-4-hydroxyphenoxy]phenyl]acetic acid is sourced from PubChem (CID 67534269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).